C23H42O3Si2 — CID 10550186
(4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyl-1,4,6,6a-tetrahydropentalen-2-one (PubChem CID 10550186) has the molecular formula C23H42O3Si2 and a molecular weight of 422.76 g/mol. Its IUPAC name is (4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyl-1,4,6,6a-tetrahydropentalen-2-one.
| Compound Name | (4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyl-1,4,6,6a-tetrahydropentalen-2-one |
|---|---|
| PubChem CID | 10550186 |
| Molecular Formula | C23H42O3Si2 |
| Molecular Weight | 422.76 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (4R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enyl-1,4,6,6a-tetrahydropentalen-2-one |
| SMILES | C=CCC1(O[Si](C)(C)C(C)(C)C)CC2CC(=O)C=C2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O3Si2/c1-12-13-23(26-28(10,11)22(5,6)7)16-17-14-18(24)15-19(17)20(23)25-27(8,9)21(2,3)4/h12,15,17,20H,1,13-14,16H2,2-11H3/t17?,20-,23?/m1/s1 |
| InChIKey | TUGYXIZVBPWDFY-WEQDKIBNSA-N |
| XLogP | 6.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.76 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|