C21H20N4O6 — CID 10550248
2-phenylethyl 2,6-dimethyl-5-nitro-4-(3-nitro-2-pyridinyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 10550248) has the molecular formula C21H20N4O6 and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-phenylethyl 2,6-dimethyl-5-nitro-4-(3-nitro-2-pyridinyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 2-phenylethyl 2,6-dimethyl-5-nitro-4-(3-nitro-2-pyridinyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10550248 |
| Molecular Formula | C21H20N4O6 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-phenylethyl 2,6-dimethyl-5-nitro-4-(3-nitro-2-pyridinyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCCc2ccccc2)C(c2ncccc2[N+](=O)[O-])C([N+](=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C21H20N4O6/c1-13-17(21(26)31-12-10-15-7-4-3-5-8-15)18(20(25(29)30)14(2)23-13)19-16(24(27)28)9-6-11-22-19/h3-9,11,18,23H,10,12H2,1-2H3 |
| InChIKey | OLMIYZIHTGJBBF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|