C25H44O5 — CID 10550278
(2S,3S,6R)-6-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-3-hydroxy-2-methylheptanoic acid (PubChem CID 10550278) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is (2S,3S,6R)-6-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-3-hydroxy-2-methylheptanoic acid.
| Compound Name | (2S,3S,6R)-6-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-3-hydroxy-2-methylheptanoic acid |
|---|---|
| PubChem CID | 10550278 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | (2S,3S,6R)-6-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-3-hydroxy-2-methylheptanoic acid |
| SMILES | C=C[C@@H](C)CC[C@@H]1O[C@@]2(CC[C@H]1C)CC[C@H](C)[C@H]([C@H](C)CC[C@H](O)[C@H](C)C(=O)O)O2 |
| InChI | InChI=1S/C25H44O5/c1-7-16(2)8-11-22-17(3)12-14-25(29-22)15-13-19(5)23(30-25)18(4)9-10-21(26)20(6)24(27)28/h7,16-23,26H,1,8-15H2,2-6H3,(H,27,28)/t16-,17-,18-,19+,20+,21+,22+,23+,25-/m1/s1 |
| InChIKey | VPBLSDBAOAQEPA-CRMFXRLMSA-N |
| XLogP | 5.41 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|