C30H50O — CID 10550383
(2R,4E,8E)-2-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol (PubChem CID 10550383) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is (2R,4E,8E)-2-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol.
| Compound Name | (2R,4E,8E)-2-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol |
|---|---|
| PubChem CID | 10550383 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | (2R,4E,8E)-2-[(5E)-6,10-dimethylundeca-1,5,9-trien-2-yl]-5,9,13-trimethyltetradeca-4,8,12-trien-1-ol |
| SMILES | C=C(CC/C=C(\C)CCC=C(C)C)[C@H](CO)C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H50O/c1-24(2)13-9-15-26(5)17-11-18-28(7)21-22-30(23-31)29(8)20-12-19-27(6)16-10-14-25(3)4/h13-14,17,19,21,30-31H,8-12,15-16,18,20,22-23H2,1-7H3/b26-17+,27-19+,28-21+/t30-/m0/s1 |
| InChIKey | AACFCESRKATSDI-SOKZWFQPSA-N |
| XLogP | 9.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|