C22H19BrO4 — CID 10550398
[(1R,2S,4S)-1-acetyloxy-4-bromo-1,2,3,4-tetrahydrochrysen-2-yl] acetate (PubChem CID 10550398) has the molecular formula C22H19BrO4 and a molecular weight of 427.29 g/mol. Its IUPAC name is [(1R,2S,4S)-1-acetyloxy-4-bromo-1,2,3,4-tetrahydrochrysen-2-yl] acetate.
| Compound Name | [(1R,2S,4S)-1-acetyloxy-4-bromo-1,2,3,4-tetrahydrochrysen-2-yl] acetate |
|---|---|
| PubChem CID | 10550398 |
| Molecular Formula | C22H19BrO4 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | [(1R,2S,4S)-1-acetyloxy-4-bromo-1,2,3,4-tetrahydrochrysen-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](Br)c2c(ccc3c2ccc2ccccc23)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H19BrO4/c1-12(24)26-20-11-19(23)21-17-8-7-14-5-3-4-6-15(14)16(17)9-10-18(21)22(20)27-13(2)25/h3-10,19-20,22H,11H2,1-2H3/t19-,20-,22+/m0/s1 |
| InChIKey | OHZLSAOJZRQXSC-JAXLGGSGSA-N |
| XLogP | 5.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|