C22H44O4Si2 — CID 10550503
trans-(1R,3S)-3-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxobutyl]-2,2-dimethylcyclopropane-1-carbaldehyde (PubChem CID 10550503) has the molecular formula C22H44O4Si2 and a molecular weight of 428.76 g/mol. Its IUPAC name is trans-(1R,3S)-3-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxobutyl]-2,2-dimethylcyclopropane-1-carbaldehyde.
| Compound Name | trans-(1R,3S)-3-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxobutyl]-2,2-dimethylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 10550503 |
| Molecular Formula | C22H44O4Si2 |
| Molecular Weight | 428.76 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | trans-(1R,3S)-3-[(1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxobutyl]-2,2-dimethylcyclopropane-1-carbaldehyde |
| SMILES | CC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1[C@@H](C=O)C1(C)C |
| InChI | InChI=1S/C22H44O4Si2/c1-15(24)18(25-27(10,11)20(2,3)4)19(17-16(14-23)22(17,8)9)26-28(12,13)21(5,6)7/h14,16-19H,1-13H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | UPYZMHFJKLAAOQ-MKXGPGLRSA-N |
| XLogP | 5.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.76 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|