C24H34O7 — CID 10550796
[(3aR,3bS,4S,5aS,9aS,9bR,10S)-10-acetyloxy-3a-hydroxy-3b,6,6,9a-tetramethyl-1-oxo-4,5,5a,7,8,9,9b,10-octahydro-3H-naphtho[2,1-e][2]benzofuran-4-yl] acetate (PubChem CID 10550796) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is [(3aR,3bS,4S,5aS,9aS,9bR,10S)-10-acetyloxy-3a-hydroxy-3b,6,6,9a-tetramethyl-1-oxo-4,5,5a,7,8,9,9b,10-octahydro-3H-naphtho[2,1-e][2]benzofuran-4-yl] acetate.
| Compound Name | [(3aR,3bS,4S,5aS,9aS,9bR,10S)-10-acetyloxy-3a-hydroxy-3b,6,6,9a-tetramethyl-1-oxo-4,5,5a,7,8,9,9b,10-octahydro-3H-naphtho[2,1-e][2]benzofuran-4-yl] acetate |
|---|---|
| PubChem CID | 10550796 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(3aR,3bS,4S,5aS,9aS,9bR,10S)-10-acetyloxy-3a-hydroxy-3b,6,6,9a-tetramethyl-1-oxo-4,5,5a,7,8,9,9b,10-octahydro-3H-naphtho[2,1-e][2]benzofuran-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C2C(=O)OC[C@@]2(O)[C@]2(C)[C@@H](OC(C)=O)C[C@H]3C(C)(C)CCC[C@]3(C)[C@@H]12 |
| InChI | InChI=1S/C24H34O7/c1-13(25)30-16-10-15-20(27)29-12-24(15,28)23(6)18(31-14(2)26)11-17-21(3,4)8-7-9-22(17,5)19(16)23/h10,16-19,28H,7-9,11-12H2,1-6H3/t16-,17-,18-,19+,22-,23+,24-/m0/s1 |
| InChIKey | ZYXRRCVRWAEDDD-VAXCZNHBSA-N |
| XLogP | 2.94 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|