C14H8Cl2N2O4S3 — CID 10550839
2,5-bis[(4-chlorophenyl)sulfonyl]-1,3,4-thiadiazole (PubChem CID 10550839) has the molecular formula C14H8Cl2N2O4S3 and a molecular weight of 435.34 g/mol. Its IUPAC name is 2,5-bis[(4-chlorophenyl)sulfonyl]-1,3,4-thiadiazole.
| Compound Name | 2,5-bis[(4-chlorophenyl)sulfonyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 10550839 |
| Molecular Formula | C14H8Cl2N2O4S3 |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 433.90 |
| IUPAC Name | 2,5-bis[(4-chlorophenyl)sulfonyl]-1,3,4-thiadiazole |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1nnc(S(=O)(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C14H8Cl2N2O4S3/c15-9-1-5-11(6-2-9)24(19,20)13-17-18-14(23-13)25(21,22)12-7-3-10(16)4-8-12/h1-8H |
| InChIKey | AFSFWKACCKZCAV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |