C24H23NO7 — CID 10550927
6,7-dimethoxy-2-methyl-4-(3,4,5-trimethoxyphenyl)benzo[f]isoindole-1,3-dione (PubChem CID 10550927) has the molecular formula C24H23NO7 and a molecular weight of 437.45 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-4-(3,4,5-trimethoxyphenyl)benzo[f]isoindole-1,3-dione.
| Compound Name | 6,7-dimethoxy-2-methyl-4-(3,4,5-trimethoxyphenyl)benzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10550927 |
| Molecular Formula | C24H23NO7 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-4-(3,4,5-trimethoxyphenyl)benzo[f]isoindole-1,3-dione |
| SMILES | COc1cc2cc3c(c(-c4cc(OC)c(OC)c(OC)c4)c2cc1OC)C(=O)N(C)C3=O |
| InChI | InChI=1S/C24H23NO7/c1-25-23(26)15-7-12-8-16(28-2)17(29-3)11-14(12)20(21(15)24(25)27)13-9-18(30-4)22(32-6)19(10-13)31-5/h7-11H,1-6H3 |
| InChIKey | SPMFHVUFODYCPG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|