About 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid
4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid (PubChem CID 10550959) has the molecular formula C24H39NO4S
and a molecular weight of 437.65 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid |
| PubChem CID | 10550959 |
| Molecular Formula | C24H39NO4S |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)C(CCC(=O)O)CS(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C24H39NO4S/c1-5-7-9-15-25(16-10-8-6-2)24(28)21(12-14-23(26)27)18-30(29)22-13-11-19(3)20(4)17-22/h11,13,17,21H,5-10,12,14-16,18H2,1-4H3,(H,26,27) |
| InChIKey | LOBVDTHAUQDXAQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid?
The IUPAC name of 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid (CID 10550959) is 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid.
What is the SMILES notation for 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid?
The canonical SMILES for 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid is CCCCCN(CCCCC)C(=O)C(CCC(=O)O)CS(=O)c1ccc(C)c(C)c1.
What is the InChIKey of 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid?
The InChIKey is LOBVDTHAUQDXAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H39NO4S/c1-5-7-9-15-25(16-10-8-6-2)24(28)21(12-14-23(26)27)18-30(29)22-13-11-19(3)20(4)17-22/h11,13,17,21H,5-10,12,14-16,18H2,1-4H3,(H,26,27).
What are the key properties of 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid?
4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid has a molecular weight of 437.65 g/mol, XLogP of 5.10, 15 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dimethylphenyl)sulfinylmethyl]-5-(dipentylamino)-5-oxopentanoic acid is sourced from PubChem (CID 10550959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).