About 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one
1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one (PubChem CID 10551326) has the molecular formula C24H31NO5S
and a molecular weight of 445.58 g/mol. Its IUPAC name is 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one.
Molecular Properties
| Compound Name | 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one |
| PubChem CID | 10551326 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)CC(NCc2ccccc2)C2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C24H31NO5S/c1-18-9-11-21(12-10-18)31(27,28)14-13-20(26)15-22(23-17-29-24(2,3)30-23)25-16-19-7-5-4-6-8-19/h4-12,22-23,25H,13-17H2,1-3H3 |
| InChIKey | CMZNXBHGMPVSHB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one?
The IUPAC name of 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one (CID 10551326) is 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one.
What is the SMILES notation for 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one?
The canonical SMILES for 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one is Cc1ccc(S(=O)(=O)CCC(=O)CC(NCc2ccccc2)C2COC(C)(C)O2)cc1.
What is the InChIKey of 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one?
The InChIKey is CMZNXBHGMPVSHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31NO5S/c1-18-9-11-21(12-10-18)31(27,28)14-13-20(26)15-22(23-17-29-24(2,3)30-23)25-16-19-7-5-4-6-8-19/h4-12,22-23,25H,13-17H2,1-3H3.
What are the key properties of 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one?
1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one has a molecular weight of 445.58 g/mol, XLogP of 3.43, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzylamino)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-(4-methylphenyl)sulfonylpentan-3-one is sourced from PubChem (CID 10551326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).