C28H35N3O2 — CID 10551331
3-[4-[6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]hexyl]-3-oxo-1,4-benzoxazin-2-yl]benzonitrile (PubChem CID 10551331) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 3-[4-[6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]hexyl]-3-oxo-1,4-benzoxazin-2-yl]benzonitrile.
| Compound Name | 3-[4-[6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]hexyl]-3-oxo-1,4-benzoxazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 10551331 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 3-[4-[6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]hexyl]-3-oxo-1,4-benzoxazin-2-yl]benzonitrile |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCCCN1C(=O)C(c2cccc(C#N)c2)Oc2ccccc21 |
| InChI | InChI=1S/C28H35N3O2/c1-21-11-9-12-22(2)30(21)17-7-3-4-8-18-31-25-15-5-6-16-26(25)33-27(28(31)32)24-14-10-13-23(19-24)20-29/h5-6,10,13-16,19,21-22,27H,3-4,7-9,11-12,17-18H2,1-2H3/t21-,22+,27? |
| InChIKey | OFCYSGMOXYGBPG-RRZWQVKKSA-N |
| XLogP | 5.85 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|