About tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate
tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate (PubChem CID 10551545) has the molecular formula C19H26Cl3NO3Si
and a molecular weight of 450.87 g/mol. Its IUPAC name is tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate |
| PubChem CID | 10551545 |
| Molecular Formula | C19H26Cl3NO3Si |
| Molecular Weight | 450.87 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate |
| SMILES | C/C=C(/CN(C(=O)OC(C)(C)C)C(=O)C(Cl)(Cl)Cl)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H26Cl3NO3Si/c1-7-14(27(5,6)15-11-9-8-10-12-15)13-23(16(24)19(20,21)22)17(25)26-18(2,3)4/h7-12H,13H2,1-6H3/b14-7- |
| InChIKey | NRMYJNQGXXKZSI-AUWJEWJLSA-N |
| XLogP | 5.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.87 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate?
The IUPAC name of tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate (CID 10551545) is tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate.
What is the SMILES notation for tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate?
The canonical SMILES for tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate is C/C=C(/CN(C(=O)OC(C)(C)C)C(=O)C(Cl)(Cl)Cl)[Si](C)(C)c1ccccc1.
What is the InChIKey of tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate?
The InChIKey is NRMYJNQGXXKZSI-AUWJEWJLSA-N. The full InChI is InChI=1S/C19H26Cl3NO3Si/c1-7-14(27(5,6)15-11-9-8-10-12-15)13-23(16(24)19(20,21)22)17(25)26-18(2,3)4/h7-12H,13H2,1-6H3/b14-7-.
What are the key properties of tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate?
tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate has a molecular weight of 450.87 g/mol, XLogP of 5.22, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(Z)-2-[dimethyl(phenyl)silyl]but-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate is sourced from PubChem (CID 10551545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).