C19H37IO2Si — CID 10551589
tert-butyl-[(1S,2R)-1-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-iodopropoxy]-dimethylsilane (PubChem CID 10551589) has the molecular formula C19H37IO2Si and a molecular weight of 452.49 g/mol. Its IUPAC name is tert-butyl-[(1S,2R)-1-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-iodopropoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R)-1-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-iodopropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10551589 |
| Molecular Formula | C19H37IO2Si |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | tert-butyl-[(1S,2R)-1-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-iodopropoxy]-dimethylsilane |
| SMILES | CC(C)=CCC/C(C)=C/CO[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)I |
| InChI | InChI=1S/C19H37IO2Si/c1-15(2)11-10-12-16(3)13-14-21-18(17(4)20)22-23(8,9)19(5,6)7/h11,13,17-18H,10,12,14H2,1-9H3/b16-13+/t17-,18+/m1/s1 |
| InChIKey | BLAISTKPNYUTAW-WWMCSRHNSA-N |
| XLogP | 6.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|