C25H28N2O6 — CID 10551596
(3R,4R)-1-benzyl-4-[(4S,5S)-5-[(2R,3R)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyazetidin-2-one (PubChem CID 10551596) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-[(4S,5S)-5-[(2R,3R)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyazetidin-2-one.
| Compound Name | (3R,4R)-1-benzyl-4-[(4S,5S)-5-[(2R,3R)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyazetidin-2-one |
|---|---|
| PubChem CID | 10551596 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (3R,4R)-1-benzyl-4-[(4S,5S)-5-[(2R,3R)-1-benzyl-3-hydroxy-4-oxoazetidin-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyazetidin-2-one |
| SMILES | CC1(C)O[C@@H]([C@H]2[C@@H](O)C(=O)N2Cc2ccccc2)[C@H]([C@H]2[C@@H](O)C(=O)N2Cc2ccccc2)O1 |
| InChI | InChI=1S/C25H28N2O6/c1-25(2)32-21(17-19(28)23(30)26(17)13-15-9-5-3-6-10-15)22(33-25)18-20(29)24(31)27(18)14-16-11-7-4-8-12-16/h3-12,17-22,28-29H,13-14H2,1-2H3/t17-,18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | LVEQTIXTZUOVHP-VXAPCQRLSA-N |
| XLogP | 1.05 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |