C21H30O11 — CID 10551834
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S)-2-oxocyclohexyl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 10551834) has the molecular formula C21H30O11 and a molecular weight of 458.46 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S)-2-oxocyclohexyl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S)-2-oxocyclohexyl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10551834 |
| Molecular Formula | C21H30O11 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S)-2-oxocyclohexyl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC[C@@H]2CCCCC2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H30O11/c1-11(22)27-10-17-18(29-12(2)23)19(30-13(3)24)20(31-14(4)25)21(32-17)28-9-15-7-5-6-8-16(15)26/h15,17-21H,5-10H2,1-4H3/t15-,17+,18+,19-,20+,21+/m0/s1 |
| InChIKey | JUDBMKVYEPJTCB-ZRWXNEIDSA-N |
| XLogP | 0.85 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|