C22H24INO2 — CID 10551946
methyl (1R,2S,3S,5S)-8-benzyl-3-(4-iodophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 10551946) has the molecular formula C22H24INO2 and a molecular weight of 461.34 g/mol. Its IUPAC name is methyl (1R,2S,3S,5S)-8-benzyl-3-(4-iodophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,2S,3S,5S)-8-benzyl-3-(4-iodophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 10551946 |
| Molecular Formula | C22H24INO2 |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | methyl (1R,2S,3S,5S)-8-benzyl-3-(4-iodophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](c2ccc(I)cc2)C[C@@H]2CC[C@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C22H24INO2/c1-26-22(25)21-19(16-7-9-17(23)10-8-16)13-18-11-12-20(21)24(18)14-15-5-3-2-4-6-15/h2-10,18-21H,11-14H2,1H3/t18-,19+,20+,21-/m0/s1 |
| InChIKey | SPTMOFIPJMIUBM-BQJUDKOJSA-N |
| XLogP | 4.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|