C23H30F3N5O2 — CID 10552132
N,N-dimethyl-2-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyridine-3-carboxamide (PubChem CID 10552132) has the molecular formula C23H30F3N5O2 and a molecular weight of 465.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyridine-3-carboxamide.
| Compound Name | N,N-dimethyl-2-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10552132 |
| Molecular Formula | C23H30F3N5O2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | N,N-dimethyl-2-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1cccnc1NCCCN1CCN(c2ccccc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C23H30F3N5O2/c1-29(2)22(32)18-7-5-10-27-21(18)28-11-6-12-30-13-15-31(16-14-30)19-8-3-4-9-20(19)33-17-23(24,25)26/h3-5,7-10H,6,11-17H2,1-2H3,(H,27,28) |
| InChIKey | CSOCCMKODQKNLN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|