C21H25NO11 — CID 10552197
methyl (2S)-2-(phenylmethoxycarbonylamino)-2-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]acetate (PubChem CID 10552197) has the molecular formula C21H25NO11 and a molecular weight of 467.43 g/mol. Its IUPAC name is methyl (2S)-2-(phenylmethoxycarbonylamino)-2-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]acetate.
| Compound Name | methyl (2S)-2-(phenylmethoxycarbonylamino)-2-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]acetate |
|---|---|
| PubChem CID | 10552197 |
| Molecular Formula | C21H25NO11 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | methyl (2S)-2-(phenylmethoxycarbonylamino)-2-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]acetate |
| SMILES | COC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H25NO11/c1-11(23)30-17-16(33-20(32-13(3)25)18(17)31-12(2)24)15(19(26)28-4)22-21(27)29-10-14-8-6-5-7-9-14/h5-9,15-18,20H,10H2,1-4H3,(H,22,27)/t15-,16+,17+,18+,20+/m0/s1 |
| InChIKey | BOOJWXIKMBLQRT-VAVNGKDRSA-N |
| XLogP | 0.61 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|