C27H36O7 — CID 10552404
[(1R,7S,8Z,12S,13S,14S,16S,18R)-14-acetyloxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadeca-3,8-dien-12-yl] 3-methylbut-2-enoate (PubChem CID 10552404) has the molecular formula C27H36O7 and a molecular weight of 472.58 g/mol. Its IUPAC name is [(1R,7S,8Z,12S,13S,14S,16S,18R)-14-acetyloxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadeca-3,8-dien-12-yl] 3-methylbut-2-enoate.
| Compound Name | [(1R,7S,8Z,12S,13S,14S,16S,18R)-14-acetyloxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadeca-3,8-dien-12-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 10552404 |
| Molecular Formula | C27H36O7 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [(1R,7S,8Z,12S,13S,14S,16S,18R)-14-acetyloxy-4,9,13,18-tetramethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadeca-3,8-dien-12-yl] 3-methylbut-2-enoate |
| SMILES | CC(=O)O[C@H]1C[C@@H]2O[C@]2(C)[C@@H]2CC3=C(C)C(=O)O[C@H]3/C=C(/C)CC[C@H](OC(=O)C=C(C)C)[C@@]12C |
| InChI | InChI=1S/C27H36O7/c1-14(2)10-24(29)33-21-9-8-15(3)11-19-18(16(4)25(30)32-19)12-20-26(21,6)22(31-17(5)28)13-23-27(20,7)34-23/h10-11,19-23H,8-9,12-13H2,1-7H3/b15-11-/t19-,20+,21-,22-,23-,26-,27+/m0/s1 |
| InChIKey | UYKZHWUYJJYTLX-UGQWMWMHSA-N |
| XLogP | 4.35 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|