C26H52O5Si — CID 10552421
ethyl (E,2R,3S,5R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-2,4,4,6-tetramethyltetradec-6-enoate (PubChem CID 10552421) has the molecular formula C26H52O5Si and a molecular weight of 472.78 g/mol. Its IUPAC name is ethyl (E,2R,3S,5R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-2,4,4,6-tetramethyltetradec-6-enoate.
| Compound Name | ethyl (E,2R,3S,5R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-2,4,4,6-tetramethyltetradec-6-enoate |
|---|---|
| PubChem CID | 10552421 |
| Molecular Formula | C26H52O5Si |
| Molecular Weight | 472.78 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | ethyl (E,2R,3S,5R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-2,4,4,6-tetramethyltetradec-6-enoate |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@@H](O)C(C)(C)[C@@H](O)[C@@H](C)C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O5Si/c1-12-14-15-16-21(31-32(10,11)25(5,6)7)18-17-19(3)22(27)26(8,9)23(28)20(4)24(29)30-13-2/h17,20-23,27-28H,12-16,18H2,1-11H3/b19-17+/t20-,21-,22-,23+/m1/s1 |
| InChIKey | VMGSVHLGURORFR-STMWZVQBSA-N |
| XLogP | 6.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.78 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|