C28H31NO6 — CID 10552605
(2R,4aR,5S,6S,7R,7aS)-5-(methoxyamino)-2-phenyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-4H-cyclopenta[d][1,3]dioxin-4a-ol (PubChem CID 10552605) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is (2R,4aR,5S,6S,7R,7aS)-5-(methoxyamino)-2-phenyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-4H-cyclopenta[d][1,3]dioxin-4a-ol.
| Compound Name | (2R,4aR,5S,6S,7R,7aS)-5-(methoxyamino)-2-phenyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-4H-cyclopenta[d][1,3]dioxin-4a-ol |
|---|---|
| PubChem CID | 10552605 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (2R,4aR,5S,6S,7R,7aS)-5-(methoxyamino)-2-phenyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-4H-cyclopenta[d][1,3]dioxin-4a-ol |
| SMILES | CON[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]2O[C@H](c3ccccc3)OC[C@]12O |
| InChI | InChI=1S/C28H31NO6/c1-31-29-25-23(32-17-20-11-5-2-6-12-20)24(33-18-21-13-7-3-8-14-21)26-28(25,30)19-34-27(35-26)22-15-9-4-10-16-22/h2-16,23-27,29-30H,17-19H2,1H3/t23-,24-,25+,26+,27-,28+/m1/s1 |
| InChIKey | RSIPSWJHVZIMEJ-NUFRCSJQSA-N |
| XLogP | 3.54 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|