C29H44N4O2 — CID 10552754
5-[7-[(7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinolin-5-yl)amino]heptylamino]-7,7-dimethyl-1,5,6,8-tetrahydroquinolin-2-one (PubChem CID 10552754) has the molecular formula C29H44N4O2 and a molecular weight of 480.70 g/mol. Its IUPAC name is 5-[7-[(7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinolin-5-yl)amino]heptylamino]-7,7-dimethyl-1,5,6,8-tetrahydroquinolin-2-one.
| Compound Name | 5-[7-[(7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinolin-5-yl)amino]heptylamino]-7,7-dimethyl-1,5,6,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 10552754 |
| Molecular Formula | C29H44N4O2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | 5-[7-[(7,7-dimethyl-2-oxo-1,5,6,8-tetrahydroquinolin-5-yl)amino]heptylamino]-7,7-dimethyl-1,5,6,8-tetrahydroquinolin-2-one |
| SMILES | CC1(C)Cc2[nH]c(=O)ccc2C(NCCCCCCCNC2CC(C)(C)Cc3[nH]c(=O)ccc32)C1 |
| InChI | InChI=1S/C29H44N4O2/c1-28(2)16-22(20-10-12-26(34)32-24(20)18-28)30-14-8-6-5-7-9-15-31-23-17-29(3,4)19-25-21(23)11-13-27(35)33-25/h10-13,22-23,30-31H,5-9,14-19H2,1-4H3,(H,32,34)(H,33,35) |
| InChIKey | QRRPMQVLEPMDBY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|