C29H27N3O4 — CID 10552769
ethyl (1R,2R,7S)-2-benzamido-5-methyl-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate (PubChem CID 10552769) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is ethyl (1R,2R,7S)-2-benzamido-5-methyl-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate.
| Compound Name | ethyl (1R,2R,7S)-2-benzamido-5-methyl-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate |
|---|---|
| PubChem CID | 10552769 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | ethyl (1R,2R,7S)-2-benzamido-5-methyl-3-oxo-1,7-diphenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N2C(=O)[C@H](NC(=O)c3ccccc3)[C@@H](c3ccccc3)N2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H27N3O4/c1-3-36-29(35)23-19(2)31-28(34)24(30-27(33)22-17-11-6-12-18-22)26(21-15-9-5-10-16-21)32(31)25(23)20-13-7-4-8-14-20/h4-18,24-26H,3H2,1-2H3,(H,30,33)/t24-,25+,26-/m1/s1 |
| InChIKey | TWQLZOMRPLWXCH-UODIDJSMSA-N |
| XLogP | 4.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |