C19H26N4O7S2 — CID 10552952
(2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-(4-methylsulfanyl-2,5-dioxoimidazolidin-1-yl)pyrrolidine-2-carboxamide (PubChem CID 10552952) has the molecular formula C19H26N4O7S2 and a molecular weight of 486.57 g/mol. Its IUPAC name is (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-(4-methylsulfanyl-2,5-dioxoimidazolidin-1-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-(4-methylsulfanyl-2,5-dioxoimidazolidin-1-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10552952 |
| Molecular Formula | C19H26N4O7S2 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-(4-methylsulfanyl-2,5-dioxoimidazolidin-1-yl)pyrrolidine-2-carboxamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2C[C@@H](N3C(=O)NC(SC)C3=O)C[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C19H26N4O7S2/c1-3-4-9-30-13-5-7-14(8-6-13)32(28,29)22-11-12(10-15(22)16(24)21-27)23-18(25)17(31-2)20-19(23)26/h5-8,12,15,17,27H,3-4,9-11H2,1-2H3,(H,20,26)(H,21,24)/t12-,15+,17?/m0/s1 |
| InChIKey | NACPMNMCCDZXLH-AJAMINHISA-N |
| XLogP | 0.74 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|