C31H30N2O4 — CID 10553253
(2E,4E)-5-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]penta-2,4-dienoic acid (PubChem CID 10553253) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is (2E,4E)-5-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 10553253 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (2E,4E)-5-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-5-phenylmethoxyindol-3-yl]penta-2,4-dienoic acid |
| SMILES | CN(CCc1ccccc1)C(=O)Cn1cc(/C=C/C=C/C(=O)O)c2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C31H30N2O4/c1-32(19-18-24-10-4-2-5-11-24)30(34)22-33-21-26(14-8-9-15-31(35)36)28-20-27(16-17-29(28)33)37-23-25-12-6-3-7-13-25/h2-17,20-21H,18-19,22-23H2,1H3,(H,35,36)/b14-8+,15-9+ |
| InChIKey | DQGCBONEVONMSD-VOMDNODZSA-N |
| XLogP | 5.58 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|