C30H30N4O3 — CID 10553254
[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] 2-phenylacetate (PubChem CID 10553254) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] 2-phenylacetate.
| Compound Name | [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 10553254 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] 2-phenylacetate |
| SMILES | Cc1c2ccnc(C(=O)NCCN(C)C)c2cc2c3cc(OC(=O)Cc4ccccc4)ccc3n(C)c12 |
| InChI | InChI=1S/C30H30N4O3/c1-19-22-12-13-31-28(30(36)32-14-15-33(2)3)24(22)18-25-23-17-21(10-11-26(23)34(4)29(19)25)37-27(35)16-20-8-6-5-7-9-20/h5-13,17-18H,14-16H2,1-4H3,(H,32,36) |
| InChIKey | SONNJBMVVVOHQN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|