C28H31FO3SSi — CID 10553261
[(3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-fluorothiolan-3-yl] benzoate (PubChem CID 10553261) has the molecular formula C28H31FO3SSi and a molecular weight of 494.70 g/mol. Its IUPAC name is [(3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-fluorothiolan-3-yl] benzoate.
| Compound Name | [(3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-fluorothiolan-3-yl] benzoate |
|---|---|
| PubChem CID | 10553261 |
| Molecular Formula | C28H31FO3SSi |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | [(3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-fluorothiolan-3-yl] benzoate |
| SMILES | CC(C)(C)[Si](OC[C@@H]1SC[C@H](OC(=O)c2ccccc2)[C@H]1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31FO3SSi/c1-28(2,3)34(22-15-9-5-10-16-22,23-17-11-6-12-18-23)31-19-25-26(29)24(20-33-25)32-27(30)21-13-7-4-8-14-21/h4-18,24-26H,19-20H2,1-3H3/t24-,25-,26+/m0/s1 |
| InChIKey | TZZKSXHKBZNMIP-KKUQBAQOSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|