C23H27F2N2O6P — CID 10553299
[[4-[[3-carbamoyl-4-(cyclohexylmethoxy)phenyl]methylcarbamoyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 10553299) has the molecular formula C23H27F2N2O6P and a molecular weight of 496.45 g/mol. Its IUPAC name is [[4-[[3-carbamoyl-4-(cyclohexylmethoxy)phenyl]methylcarbamoyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[[3-carbamoyl-4-(cyclohexylmethoxy)phenyl]methylcarbamoyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 10553299 |
| Molecular Formula | C23H27F2N2O6P |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [[4-[[3-carbamoyl-4-(cyclohexylmethoxy)phenyl]methylcarbamoyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | NC(=O)c1cc(CNC(=O)c2ccc(C(F)(F)P(=O)(O)O)cc2)ccc1OCC1CCCCC1 |
| InChI | InChI=1S/C23H27F2N2O6P/c24-23(25,34(30,31)32)18-9-7-17(8-10-18)22(29)27-13-16-6-11-20(19(12-16)21(26)28)33-14-15-4-2-1-3-5-15/h6-12,15H,1-5,13-14H2,(H2,26,28)(H,27,29)(H2,30,31,32) |
| InChIKey | NZQWBVZQHZDVAZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|