C28H36N2O6 — CID 10553316
(2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-1-[2-[hexyl(methyl)amino]-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 10553316) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is (2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-1-[2-[hexyl(methyl)amino]-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-1-[2-[hexyl(methyl)amino]-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 10553316 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (2S,3S,4R)-4-(1,3-benzodioxol-5-yl)-1-[2-[hexyl(methyl)amino]-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCCCCN(C)C(=O)CN1C[C@@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H36N2O6/c1-4-5-6-7-14-29(2)25(31)17-30-16-22(20-10-13-23-24(15-20)36-18-35-23)26(28(32)33)27(30)19-8-11-21(34-3)12-9-19/h8-13,15,22,26-27H,4-7,14,16-18H2,1-3H3,(H,32,33)/t22-,26-,27+/m0/s1 |
| InChIKey | JIGJEGNQTUNWHV-WDDWZANVSA-N |
| XLogP | 4.30 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|