C19H3F10NO4 — CID 10553408
bis(2,3,4,5,6-pentafluorophenyl) pyridine-2,6-dicarboxylate (PubChem CID 10553408) has the molecular formula C19H3F10NO4 and a molecular weight of 499.22 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl) pyridine-2,6-dicarboxylate.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl) pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 10553408 |
| Molecular Formula | C19H3F10NO4 |
| Molecular Weight | 499.22 g/mol |
| Exact Mass | 498.99 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl) pyridine-2,6-dicarboxylate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1cccc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C19H3F10NO4/c20-6-8(22)12(26)16(13(27)9(6)23)33-18(31)4-2-1-3-5(30-4)19(32)34-17-14(28)10(24)7(21)11(25)15(17)29/h1-3H |
| InChIKey | NDEDHSJMFFAJLX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|