C11H10F13O5P — CID 10553433
2-(2-diethoxyphosphoryl-1,1,2,2-tetrafluoroethoxy)-1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propane (PubChem CID 10553433) has the molecular formula C11H10F13O5P and a molecular weight of 500.14 g/mol. Its IUPAC name is 2-(2-diethoxyphosphoryl-1,1,2,2-tetrafluoroethoxy)-1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propane.
| Compound Name | 2-(2-diethoxyphosphoryl-1,1,2,2-tetrafluoroethoxy)-1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propane |
|---|---|
| PubChem CID | 10553433 |
| Molecular Formula | C11H10F13O5P |
| Molecular Weight | 500.14 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | 2-(2-diethoxyphosphoryl-1,1,2,2-tetrafluoroethoxy)-1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C11H10F13O5P/c1-3-26-30(25,27-4-2)11(23,24)10(21,22)29-7(15,8(16,17)18)9(19,20)28-6(14)5(12)13/h3-4H2,1-2H3 |
| InChIKey | BPDFBTWQWLQMLV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.14 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|