About benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate
benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate (PubChem CID 10553523) has the molecular formula C29H21N5O2S
and a molecular weight of 503.59 g/mol. Its IUPAC name is benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate |
| PubChem CID | 10553523 |
| Molecular Formula | C29H21N5O2S |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate |
| SMILES | O=C(On1nnc2ccccc21)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C29H21N5O2S/c35-27(36-34-26-19-11-10-18-24(26)32-33-34)25-20-37-28(30-25)31-29(21-12-4-1-5-13-21,22-14-6-2-7-15-22)23-16-8-3-9-17-23/h1-20H,(H,30,31) |
| InChIKey | REDJQCZPQDIUQT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate?
The IUPAC name of benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate (CID 10553523) is benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate?
The canonical SMILES for benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate is O=C(On1nnc2ccccc21)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate?
The InChIKey is REDJQCZPQDIUQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H21N5O2S/c35-27(36-34-26-19-11-10-18-24(26)32-33-34)25-20-37-28(30-25)31-29(21-12-4-1-5-13-21,22-14-6-2-7-15-22)23-16-8-3-9-17-23/h1-20H,(H,30,31).
What are the key properties of benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate?
benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate has a molecular weight of 503.59 g/mol, XLogP of 5.56, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-1-yl 2-(tritylamino)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 10553523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).