C34H55NO2 — CID 10553724
(2R,4aS,6aR,6aS,6bR,8aR,12aR,14bR)-N-butyl-2,4a,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-2-carboxamide (PubChem CID 10553724) has the molecular formula C34H55NO2 and a molecular weight of 509.82 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,6bR,8aR,12aR,14bR)-N-butyl-2,4a,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-2-carboxamide.
| Compound Name | (2R,4aS,6aR,6aS,6bR,8aR,12aR,14bR)-N-butyl-2,4a,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 10553724 |
| Molecular Formula | C34H55NO2 |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 509.42 |
| IUPAC Name | (2R,4aS,6aR,6aS,6bR,8aR,12aR,14bR)-N-butyl-2,4a,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-2-carboxamide |
| SMILES | CCCCNC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C34H55NO2/c1-9-10-21-35-28(37)31(5)18-17-30(4)19-20-33(7)23(24(30)22-31)11-12-26-32(6)15-14-27(36)29(2,3)25(32)13-16-34(26,33)8/h11,24-26H,9-10,12-22H2,1-8H3,(H,35,37)/t24-,25-,26+,30+,31+,32-,33+,34+/m0/s1 |
| InChIKey | XPPXHWNYUFYKQS-BVRPFHMCSA-N |
| XLogP | 8.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|