C22H20F6O3S2 — CID 10553732
4-[2-[5-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde (PubChem CID 10553732) has the molecular formula C22H20F6O3S2 and a molecular weight of 510.52 g/mol. Its IUPAC name is 4-[2-[5-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde.
| Compound Name | 4-[2-[5-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 10553732 |
| Molecular Formula | C22H20F6O3S2 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 4-[2-[5-(5,5-dimethyl-1,3-dioxan-2-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde |
| SMILES | Cc1sc(C=O)cc1C1=C(c2cc(C3OCC(C)(C)CO3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C22H20F6O3S2/c1-10-13(5-12(7-29)32-10)16-17(21(25,26)22(27,28)20(16,23)24)14-6-15(33-11(14)2)18-30-8-19(3,4)9-31-18/h5-7,18H,8-9H2,1-4H3 |
| InChIKey | LPUCIPVDKHLYLG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|