C16H22N2O11S3 — CID 10553854
[(1S,2S,6R,9S)-11,11-dimethyl-4-(4-methylphenyl)sulfonylimino-4-oxo-3,5,8,10,12-pentaoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate (PubChem CID 10553854) has the molecular formula C16H22N2O11S3 and a molecular weight of 514.56 g/mol. Its IUPAC name is [(1S,2S,6R,9S)-11,11-dimethyl-4-(4-methylphenyl)sulfonylimino-4-oxo-3,5,8,10,12-pentaoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate.
| Compound Name | [(1S,2S,6R,9S)-11,11-dimethyl-4-(4-methylphenyl)sulfonylimino-4-oxo-3,5,8,10,12-pentaoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate |
|---|---|
| PubChem CID | 10553854 |
| Molecular Formula | C16H22N2O11S3 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | [(1S,2S,6R,9S)-11,11-dimethyl-4-(4-methylphenyl)sulfonylimino-4-oxo-3,5,8,10,12-pentaoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate |
| SMILES | Cc1ccc(S(=O)(=O)N=S2(=O)O[C@@H]3[C@@H](CO[C@@]4(COS(N)(=O)=O)OC(C)(C)O[C@@H]34)O2)cc1 |
| InChI | InChI=1S/C16H22N2O11S3/c1-10-4-6-11(7-5-10)30(19,20)18-32(23)27-12-8-24-16(9-25-31(17,21)22)14(13(12)28-32)26-15(2,3)29-16/h4-7,12-14H,8-9H2,1-3H3,(H2,17,21,22)/t12-,13-,14+,16+,32?/m1/s1 |
| InChIKey | HTAPHPJVYGRPLT-QXDZJLDXSA-N |
| XLogP | -0.14 |
| TPSA | 179.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |