C34H36O5 — CID 10554074
(2R,3R,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxane (PubChem CID 10554074) has the molecular formula C34H36O5 and a molecular weight of 524.66 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 10554074 |
| Molecular Formula | C34H36O5 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | (2R,3R,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
| SMILES | c1ccc(COC[C@H]2OC[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H36O5/c1-5-13-27(14-6-1)21-35-25-31-33(38-23-29-17-9-3-10-18-29)34(39-24-30-19-11-4-12-20-30)32(26-37-31)36-22-28-15-7-2-8-16-28/h1-20,31-34H,21-26H2/t31-,32-,33-,34-/m1/s1 |
| InChIKey | QKZMWYJFJHCINI-YFRBGRBWSA-N |
| XLogP | 6.36 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |