C29H25N3O5S — CID 10554144
prop-2-enyl 1-benzyl-4-(4-cyanophenyl)-2-oxo-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 10554144) has the molecular formula C29H25N3O5S and a molecular weight of 527.60 g/mol. Its IUPAC name is prop-2-enyl 1-benzyl-4-(4-cyanophenyl)-2-oxo-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate.
| Compound Name | prop-2-enyl 1-benzyl-4-(4-cyanophenyl)-2-oxo-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10554144 |
| Molecular Formula | C29H25N3O5S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | prop-2-enyl 1-benzyl-4-(4-cyanophenyl)-2-oxo-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | C=CCOC(=O)C1C(=O)N(Cc2ccccc2)C(c2ccc(S(N)(=O)=O)cc2)=CC1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C29H25N3O5S/c1-2-16-37-29(34)27-25(22-10-8-20(18-30)9-11-22)17-26(23-12-14-24(15-13-23)38(31,35)36)32(28(27)33)19-21-6-4-3-5-7-21/h2-15,17,25,27H,1,16,19H2,(H2,31,35,36) |
| InChIKey | NGASNNAEFBOLIW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|