C31H46O7 — CID 10554225
(1S,4R,5'S,6'R,7R,8R,9S,10E,12E,14R,16E,19R,21R)-7,8,9-trihydroxy-5',6,6',10,14,16-hexamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3-one (PubChem CID 10554225) has the molecular formula C31H46O7 and a molecular weight of 530.70 g/mol. Its IUPAC name is (1S,4R,5'S,6'R,7R,8R,9S,10E,12E,14R,16E,19R,21R)-7,8,9-trihydroxy-5',6,6',10,14,16-hexamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3-one.
| Compound Name | (1S,4R,5'S,6'R,7R,8R,9S,10E,12E,14R,16E,19R,21R)-7,8,9-trihydroxy-5',6,6',10,14,16-hexamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3-one |
|---|---|
| PubChem CID | 10554225 |
| Molecular Formula | C31H46O7 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | (1S,4R,5'S,6'R,7R,8R,9S,10E,12E,14R,16E,19R,21R)-7,8,9-trihydroxy-5',6,6',10,14,16-hexamethylspiro[2,20-dioxatricyclo[17.3.1.04,9]tricosa-5,10,12,16-tetraene-21,2'-oxane]-3-one |
| SMILES | CC1=C[C@H]2C(=O)O[C@H]3C[C@@H](C/C=C(\C)C[C@@H](C)/C=C/C=C(\C)[C@]2(O)[C@H](O)[C@@H]1O)O[C@@]1(CC[C@H](C)[C@@H](C)O1)C3 |
| InChI | InChI=1S/C31H46O7/c1-18-8-7-9-22(5)31(35)26(15-21(4)27(32)28(31)33)29(34)36-25-16-24(11-10-19(2)14-18)38-30(17-25)13-12-20(3)23(6)37-30/h7-10,15,18,20,23-28,32-33,35H,11-14,16-17H2,1-6H3/b8-7+,19-10+,22-9+/t18-,20-,23+,24+,25-,26-,27+,28+,30-,31+/m0/s1 |
| InChIKey | BAYQGUBTKMOTSJ-WZCFKJIISA-N |
| XLogP | 4.52 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|