C21H14Br2N8 — CID 10554389
[2-bromo-5-[5-[4-bromo-3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]pentyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide (PubChem CID 10554389) has the molecular formula C21H14Br2N8 and a molecular weight of 538.21 g/mol. Its IUPAC name is [2-bromo-5-[5-[4-bromo-3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]pentyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide.
| Compound Name | [2-bromo-5-[5-[4-bromo-3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]pentyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 10554389 |
| Molecular Formula | C21H14Br2N8 |
| Molecular Weight | 538.21 g/mol |
| Exact Mass | 535.97 |
| IUPAC Name | [2-bromo-5-[5-[4-bromo-3,6-bis(cyanoimino)cyclohexa-1,4-dien-1-yl]pentyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide |
| SMILES | N#C/N=C1\C=C(CCCCCC2=C/C(=N\C#N)C(Br)=C/C2=N\C#N)/C(=N/C#N)C=C1Br |
| InChI | InChI=1S/C21H14Br2N8/c22-16-8-18(28-10-24)14(6-20(16)30-12-26)4-2-1-3-5-15-7-21(31-13-27)17(23)9-19(15)29-11-25/h6-9H,1-5H2/b28-18+,29-19+,30-20+,31-21+ |
| InChIKey | VOFPDJDVLSTRJG-GDGKAMMSSA-N |
| XLogP | 5.06 |
| TPSA | 144.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.21 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|