C29H30O10 — CID 10554392
[(6R,6aS,11bR)-1,3,9-trimethoxy-6-(3,4,5-trimethoxyphenyl)-6a,11b-dihydro-6H-[1]benzofuro[2,3-c]chromen-11-yl] acetate (PubChem CID 10554392) has the molecular formula C29H30O10 and a molecular weight of 538.55 g/mol. Its IUPAC name is [(6R,6aS,11bR)-1,3,9-trimethoxy-6-(3,4,5-trimethoxyphenyl)-6a,11b-dihydro-6H-[1]benzofuro[2,3-c]chromen-11-yl] acetate.
| Compound Name | [(6R,6aS,11bR)-1,3,9-trimethoxy-6-(3,4,5-trimethoxyphenyl)-6a,11b-dihydro-6H-[1]benzofuro[2,3-c]chromen-11-yl] acetate |
|---|---|
| PubChem CID | 10554392 |
| Molecular Formula | C29H30O10 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | [(6R,6aS,11bR)-1,3,9-trimethoxy-6-(3,4,5-trimethoxyphenyl)-6a,11b-dihydro-6H-[1]benzofuro[2,3-c]chromen-11-yl] acetate |
| SMILES | COc1cc(OC(C)=O)c2c(c1)O[C@H]1[C@@H]2c2c(OC)cc(OC)cc2O[C@@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C29H30O10/c1-14(30)37-19-11-17(32-3)13-21-25(19)26-24-18(33-4)10-16(31-2)12-20(24)38-27(29(26)39-21)15-8-22(34-5)28(36-7)23(9-15)35-6/h8-13,26-27,29H,1-7H3/t26-,27-,29+/m1/s1 |
| InChIKey | ARAXCEPEXVMWCC-QQJNOOCOSA-N |
| XLogP | 4.69 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|