C30H35FO4SSi — CID 10554417
[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-phenylmethoxythiolan-2-yl] acetate (PubChem CID 10554417) has the molecular formula C30H35FO4SSi and a molecular weight of 538.76 g/mol. Its IUPAC name is [(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-phenylmethoxythiolan-2-yl] acetate.
| Compound Name | [(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-phenylmethoxythiolan-2-yl] acetate |
|---|---|
| PubChem CID | 10554417 |
| Molecular Formula | C30H35FO4SSi |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | [(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-phenylmethoxythiolan-2-yl] acetate |
| SMILES | CC(=O)OC1S[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OCc2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C30H35FO4SSi/c1-22(32)35-29-27(31)28(33-20-23-14-8-5-9-15-23)26(36-29)21-34-37(30(2,3)4,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,26-29H,20-21H2,1-4H3/t26-,27+,28-,29?/m1/s1 |
| InChIKey | QGISPVYOXGHZHI-WZKCMNIOSA-N |
| XLogP | 5.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|