C31H36NO6P — CID 10554666
tert-butyl (2S)-6-dimethoxyphosphoryl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]hexanoate (PubChem CID 10554666) has the molecular formula C31H36NO6P and a molecular weight of 549.60 g/mol. Its IUPAC name is tert-butyl (2S)-6-dimethoxyphosphoryl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]hexanoate.
| Compound Name | tert-butyl (2S)-6-dimethoxyphosphoryl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]hexanoate |
|---|---|
| PubChem CID | 10554666 |
| Molecular Formula | C31H36NO6P |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | tert-butyl (2S)-6-dimethoxyphosphoryl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]hexanoate |
| SMILES | COP(=O)(CC(=O)CC[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C31H36NO6P/c1-30(2,3)38-29(34)28(20-19-23(33)21-39(35,36-4)37-5)32-31(22-13-7-6-8-14-22)26-17-11-9-15-24(26)25-16-10-12-18-27(25)31/h6-18,28,32H,19-21H2,1-5H3/t28-/m0/s1 |
| InChIKey | NHDXYWCCZSRNIT-NDEPHWFRSA-N |
| XLogP | 6.09 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|