C31H38O5SSi — CID 10554706
(3aS,4S,6R,7R,7aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 10554706) has the molecular formula C31H38O5SSi and a molecular weight of 550.79 g/mol. Its IUPAC name is (3aS,4S,6R,7R,7aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aS,4S,6R,7R,7aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 10554706 |
| Molecular Formula | C31H38O5SSi |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | (3aS,4S,6R,7R,7aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O[C@@H](Sc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C31H38O5SSi/c1-30(2,3)38(23-17-11-7-12-18-23,24-19-13-8-14-20-24)33-21-25-26(32)27-28(36-31(4,5)35-27)29(34-25)37-22-15-9-6-10-16-22/h6-20,25-29,32H,21H2,1-5H3/t25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | KXWKAUBGGGPLRN-PNHLWVRCSA-N |
| XLogP | 4.96 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|