C22H27IOSn — CID 10554754
iodo-[(1S,2R,3R,4R)-3-(methoxymethyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-diphenylstannane (PubChem CID 10554754) has the molecular formula C22H27IOSn and a molecular weight of 553.07 g/mol. Its IUPAC name is iodo-[(1S,2R,3R,4R)-3-(methoxymethyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-diphenylstannane.
| Compound Name | iodo-[(1S,2R,3R,4R)-3-(methoxymethyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-diphenylstannane |
|---|---|
| PubChem CID | 10554754 |
| Molecular Formula | C22H27IOSn |
| Molecular Weight | 553.07 g/mol |
| Exact Mass | 554.01 |
| IUPAC Name | iodo-[(1S,2R,3R,4R)-3-(methoxymethyl)-3-methyl-2-bicyclo[2.2.1]heptanyl]-diphenylstannane |
| SMILES | COC[C@@]1(C)[C@@H]2CC[C@@H](C2)[C@H]1[Sn](I)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C10H17O.2C6H5.HI.Sn/c1-10(7-11-2)6-8-3-4-9(10)5-8;2*1-2-4-6-5-3-1;;/h6,8-9H,3-5,7H2,1-2H3;2*1-5H;1H;/q;;;;+1/p-1/t8-,9+,10-;;;;/m0..../s1 |
| InChIKey | KVEAVPBNNKKDQY-UNRASZFFSA-M |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.07 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|