C33H30O8 — CID 10554770
(6aR,12aR)-12-[5-[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]-2-methoxyphenyl]-3-methoxy-6a,12-dihydro-6H-chromeno[2,3-c]chromene-9,12a-diol (PubChem CID 10554770) has the molecular formula C33H30O8 and a molecular weight of 554.60 g/mol. Its IUPAC name is (6aR,12aR)-12-[5-[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]-2-methoxyphenyl]-3-methoxy-6a,12-dihydro-6H-chromeno[2,3-c]chromene-9,12a-diol.
| Compound Name | (6aR,12aR)-12-[5-[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]-2-methoxyphenyl]-3-methoxy-6a,12-dihydro-6H-chromeno[2,3-c]chromene-9,12a-diol |
|---|---|
| PubChem CID | 10554770 |
| Molecular Formula | C33H30O8 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | (6aR,12aR)-12-[5-[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]-2-methoxyphenyl]-3-methoxy-6a,12-dihydro-6H-chromeno[2,3-c]chromene-9,12a-diol |
| SMILES | COc1ccc2c(c1)OC[C@H]1Oc3cc(O)ccc3C(c3cc([C@@H]4COc5cc(O)ccc5C4)ccc3OC)[C@@]21O |
| InChI | InChI=1S/C33H30O8/c1-37-23-7-9-26-30(15-23)40-17-31-33(26,36)32(24-8-6-22(35)14-29(24)41-31)25-12-18(4-10-27(25)38-2)20-11-19-3-5-21(34)13-28(19)39-16-20/h3-10,12-15,20,31-32,34-36H,11,16-17H2,1-2H3/t20-,31+,32?,33+/m0/s1 |
| InChIKey | AAYNXSSLTTZFMB-PUVHLHJNSA-N |
| XLogP | 5.01 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |