C40H45NO2 — CID 10555100
(2S,4E,7R)-7,11-dimethyl-1-phenylmethoxy-2-(tritylamino)dodeca-4,10-dien-3-one (PubChem CID 10555100) has the molecular formula C40H45NO2 and a molecular weight of 571.81 g/mol. Its IUPAC name is (2S,4E,7R)-7,11-dimethyl-1-phenylmethoxy-2-(tritylamino)dodeca-4,10-dien-3-one.
| Compound Name | (2S,4E,7R)-7,11-dimethyl-1-phenylmethoxy-2-(tritylamino)dodeca-4,10-dien-3-one |
|---|---|
| PubChem CID | 10555100 |
| Molecular Formula | C40H45NO2 |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | (2S,4E,7R)-7,11-dimethyl-1-phenylmethoxy-2-(tritylamino)dodeca-4,10-dien-3-one |
| SMILES | CC(C)=CCC[C@@H](C)C/C=C/C(=O)[C@H](COCc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H45NO2/c1-32(2)18-16-19-33(3)20-17-29-39(42)38(31-43-30-34-21-8-4-9-22-34)41-40(35-23-10-5-11-24-35,36-25-12-6-13-26-36)37-27-14-7-15-28-37/h4-15,17-18,21-29,33,38,41H,16,19-20,30-31H2,1-3H3/b29-17+/t33-,38+/m1/s1 |
| InChIKey | KGVJPQSJECOAOK-ZZKAXECJSA-N |
| XLogP | 9.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|