C29H40F3N7O2 — CID 10555166
3-tert-butyl-N,N,1-trimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 10555166) has the molecular formula C29H40F3N7O2 and a molecular weight of 575.68 g/mol. Its IUPAC name is 3-tert-butyl-N,N,1-trimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 3-tert-butyl-N,N,1-trimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 10555166 |
| Molecular Formula | C29H40F3N7O2 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | 3-tert-butyl-N,N,1-trimethyl-4-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propylamino]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CN(C)C(=O)c1cnc2c(c(C(C)(C)C)nn2C)c1NCCCN1CCN(c2ccccc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C29H40F3N7O2/c1-28(2,3)25-23-24(20(27(40)36(4)5)18-34-26(23)37(6)35-25)33-12-9-13-38-14-16-39(17-15-38)21-10-7-8-11-22(21)41-19-29(30,31)32/h7-8,10-11,18H,9,12-17,19H2,1-6H3,(H,33,34) |
| InChIKey | KGQVWTUDJMKFST-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|