C24H14F13P — CID 10555235
diphenyl-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]phosphane (PubChem CID 10555235) has the molecular formula C24H14F13P and a molecular weight of 580.32 g/mol. Its IUPAC name is diphenyl-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]phosphane.
| Compound Name | diphenyl-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]phosphane |
|---|---|
| PubChem CID | 10555235 |
| Molecular Formula | C24H14F13P |
| Molecular Weight | 580.32 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | diphenyl-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]phosphane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H14F13P/c25-19(26,20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)37)15-11-13-18(14-12-15)38(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H |
| InChIKey | XXPCCDHFSCVUBW-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.32 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|