C35H35NO5S — CID 10555266
(2S,3R,4S,5S,6R)-2-isothiocyanato-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 10555266) has the molecular formula C35H35NO5S and a molecular weight of 581.73 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-isothiocyanato-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3R,4S,5S,6R)-2-isothiocyanato-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 10555266 |
| Molecular Formula | C35H35NO5S |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-isothiocyanato-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | S=C=N[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H35NO5S/c42-26-36-35-34(40-24-30-19-11-4-12-20-30)33(39-23-29-17-9-3-10-18-29)32(38-22-28-15-7-2-8-16-28)31(41-35)25-37-21-27-13-5-1-6-14-27/h1-20,31-35H,21-25H2/t31-,32+,33+,34-,35+/m1/s1 |
| InChIKey | BMGXVGKYTCAXKD-NVCPMKERSA-N |
| XLogP | 6.79 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|